C17H13N13O10S2 — CID 141463642
[2-[(2E)-2-[[3,5-dinitro-6-[[2-(sulfodiazenyl)anilino]diazenyl]-2-pyridinyl]imino]hydrazinyl]phenyl]iminosulfamic acid (PubChem CID 141463642) has the molecular formula C17H13N13O10S2 and a molecular weight of 623.51 g/mol. Its IUPAC name is [2-[(2E)-2-[[3,5-dinitro-6-[[2-(sulfodiazenyl)anilino]diazenyl]-2-pyridinyl]imino]hydrazinyl]phenyl]iminosulfamic acid.
| Compound Name | [2-[(2E)-2-[[3,5-dinitro-6-[[2-(sulfodiazenyl)anilino]diazenyl]-2-pyridinyl]imino]hydrazinyl]phenyl]iminosulfamic acid |
|---|---|
| PubChem CID | 141463642 |
| Molecular Formula | C17H13N13O10S2 |
| Molecular Weight | 623.51 g/mol |
| Exact Mass | 623.03 |
| IUPAC Name | [2-[(2E)-2-[[3,5-dinitro-6-[[2-(sulfodiazenyl)anilino]diazenyl]-2-pyridinyl]imino]hydrazinyl]phenyl]iminosulfamic acid |
| SMILES | O=[N+]([O-])c1cc([N+](=O)[O-])c(/N=N/Nc2ccccc2/N=N/S(=O)(=O)O)nc1/N=N/Nc1ccccc1/N=N\S(=O)(=O)O |
| InChI | InChI=1S/C17H13N13O10S2/c31-29(32)14-9-15(30(33)34)17(24-26-20-11-6-2-4-8-13(11)22-28-42(38,39)40)18-16(14)23-25-19-10-5-1-3-7-12(10)21-27-41(35,36)37/h1-9H,(H,35,36,37)(H,38,39,40)(H2,18,19,20,23,24)/b27-21-,28-22+ |
| InChIKey | MSJPYOZKRAIIGG-KKTFQPMKSA-N |
| XLogP | 4.89 |
| TPSA | 330.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.51 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|