About N-[2-[4-[(E)-2-(1,3-benzothiazol-2-yl)ethenyl]phenoxy]ethyl]-N-butylbutan-1-amine
N-[2-[4-[(E)-2-(1,3-benzothiazol-2-yl)ethenyl]phenoxy]ethyl]-N-butylbutan-1-amine (PubChem CID 14146386) has the molecular formula C25H32N2OS
and a molecular weight of 408.61 g/mol. Its IUPAC name is N-[2-[4-[(E)-2-(1,3-benzothiazol-2-yl)ethenyl]phenoxy]ethyl]-N-butylbutan-1-amine.
Molecular Properties
| Compound Name | N-[2-[4-[(E)-2-(1,3-benzothiazol-2-yl)ethenyl]phenoxy]ethyl]-N-butylbutan-1-amine |
| PubChem CID | 14146386 |
| Molecular Formula | C25H32N2OS |
| Molecular Weight | 408.61 g/mol |
| Exact Mass | 408.22 |
| IUPAC Name | N-[2-[4-[(E)-2-(1,3-benzothiazol-2-yl)ethenyl]phenoxy]ethyl]-N-butylbutan-1-amine |
| SMILES | CCCCN(CCCC)CCOc1ccc(/C=C/c2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C25H32N2OS/c1-3-5-17-27(18-6-4-2)19-20-28-22-14-11-21(12-15-22)13-16-25-26-23-9-7-8-10-24(23)29-25/h7-16H,3-6,17-20H2,1-2H3/b16-13+ |
| InChIKey | YOMNNEKNBVZXEH-DTQAZKPQSA-N |
| XLogP | 6.75 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 408.61 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[2-[4-[(E)-2-(1,3-benzothiazol-2-yl)ethenyl]phenoxy]ethyl]-N-butylbutan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-[4-[(E)-2-(1,3-benzothiazol-2-yl)ethenyl]phenoxy]ethyl]-N-butylbutan-1-amine?
The IUPAC name of N-[2-[4-[(E)-2-(1,3-benzothiazol-2-yl)ethenyl]phenoxy]ethyl]-N-butylbutan-1-amine (CID 14146386) is N-[2-[4-[(E)-2-(1,3-benzothiazol-2-yl)ethenyl]phenoxy]ethyl]-N-butylbutan-1-amine.
What is the SMILES notation for N-[2-[4-[(E)-2-(1,3-benzothiazol-2-yl)ethenyl]phenoxy]ethyl]-N-butylbutan-1-amine?
The canonical SMILES for N-[2-[4-[(E)-2-(1,3-benzothiazol-2-yl)ethenyl]phenoxy]ethyl]-N-butylbutan-1-amine is CCCCN(CCCC)CCOc1ccc(/C=C/c2nc3ccccc3s2)cc1.
What is the InChIKey of N-[2-[4-[(E)-2-(1,3-benzothiazol-2-yl)ethenyl]phenoxy]ethyl]-N-butylbutan-1-amine?
The InChIKey is YOMNNEKNBVZXEH-DTQAZKPQSA-N. The full InChI is InChI=1S/C25H32N2OS/c1-3-5-17-27(18-6-4-2)19-20-28-22-14-11-21(12-15-22)13-16-25-26-23-9-7-8-10-24(23)29-25/h7-16H,3-6,17-20H2,1-2H3/b16-13+.
What are the key properties of N-[2-[4-[(E)-2-(1,3-benzothiazol-2-yl)ethenyl]phenoxy]ethyl]-N-butylbutan-1-amine?
N-[2-[4-[(E)-2-(1,3-benzothiazol-2-yl)ethenyl]phenoxy]ethyl]-N-butylbutan-1-amine has a molecular weight of 408.61 g/mol, XLogP of 6.75, 12 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-[4-[(E)-2-(1,3-benzothiazol-2-yl)ethenyl]phenoxy]ethyl]-N-butylbutan-1-amine is sourced from PubChem (CID 14146386), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).