C18H38O — CID 141463943
2,2,3,4-tetramethyl-3-(2,2,3,4-tetramethylpentan-3-yloxy)pentane (PubChem CID 141463943) has the molecular formula C18H38O and a molecular weight of 270.50 g/mol. Its IUPAC name is 2,2,3,4-tetramethyl-3-(2,2,3,4-tetramethylpentan-3-yloxy)pentane.
| Compound Name | 2,2,3,4-tetramethyl-3-(2,2,3,4-tetramethylpentan-3-yloxy)pentane |
|---|---|
| PubChem CID | 141463943 |
| Molecular Formula | C18H38O |
| Molecular Weight | 270.50 g/mol |
| Exact Mass | 270.29 |
| IUPAC Name | 2,2,3,4-tetramethyl-3-(2,2,3,4-tetramethylpentan-3-yloxy)pentane |
| SMILES | CC(C)C(C)(OC(C)(C(C)C)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C18H38O/c1-13(2)17(11,15(5,6)7)19-18(12,14(3)4)16(8,9)10/h13-14H,1-12H3 |
| InChIKey | GDKJSJNDMWDQFC-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.50 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |