About 1-[4-(dimethylaminomethylideneamino)-3,5-dimethylphenyl]ethyl acetate
1-[4-(dimethylaminomethylideneamino)-3,5-dimethylphenyl]ethyl acetate (PubChem CID 14146433) has the molecular formula C15H22N2O2
and a molecular weight of 262.35 g/mol. Its IUPAC name is 1-[4-(dimethylaminomethylideneamino)-3,5-dimethylphenyl]ethyl acetate.
Molecular Properties
| Compound Name | 1-[4-(dimethylaminomethylideneamino)-3,5-dimethylphenyl]ethyl acetate |
| PubChem CID | 14146433 |
| Molecular Formula | C15H22N2O2 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | 1-[4-(dimethylaminomethylideneamino)-3,5-dimethylphenyl]ethyl acetate |
| SMILES | CC(=O)OC(C)c1cc(C)c(/N=C/N(C)C)c(C)c1 |
| InChI | InChI=1S/C15H22N2O2/c1-10-7-14(12(3)19-13(4)18)8-11(2)15(10)16-9-17(5)6/h7-9,12H,1-6H3/b16-9+ |
| InChIKey | OBFFTLSSYKNWGI-CXUHLZMHSA-N |
| XLogP | 3.15 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1-[4-(dimethylaminomethylideneamino)-3,5-dimethylphenyl]ethyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(dimethylaminomethylideneamino)-3,5-dimethylphenyl]ethyl acetate?
The IUPAC name of 1-[4-(dimethylaminomethylideneamino)-3,5-dimethylphenyl]ethyl acetate (CID 14146433) is 1-[4-(dimethylaminomethylideneamino)-3,5-dimethylphenyl]ethyl acetate.
What is the SMILES notation for 1-[4-(dimethylaminomethylideneamino)-3,5-dimethylphenyl]ethyl acetate?
The canonical SMILES for 1-[4-(dimethylaminomethylideneamino)-3,5-dimethylphenyl]ethyl acetate is CC(=O)OC(C)c1cc(C)c(/N=C/N(C)C)c(C)c1.
What is the InChIKey of 1-[4-(dimethylaminomethylideneamino)-3,5-dimethylphenyl]ethyl acetate?
The InChIKey is OBFFTLSSYKNWGI-CXUHLZMHSA-N. The full InChI is InChI=1S/C15H22N2O2/c1-10-7-14(12(3)19-13(4)18)8-11(2)15(10)16-9-17(5)6/h7-9,12H,1-6H3/b16-9+.
What are the key properties of 1-[4-(dimethylaminomethylideneamino)-3,5-dimethylphenyl]ethyl acetate?
1-[4-(dimethylaminomethylideneamino)-3,5-dimethylphenyl]ethyl acetate has a molecular weight of 262.35 g/mol, XLogP of 3.15, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(dimethylaminomethylideneamino)-3,5-dimethylphenyl]ethyl acetate is sourced from PubChem (CID 14146433), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).