C22H28N2O2 — CID 141464384
1,2-bis(2-amino-5-tert-butylphenyl)ethane-1,2-dione (PubChem CID 141464384) has the molecular formula C22H28N2O2 and a molecular weight of 352.48 g/mol. Its IUPAC name is 1,2-bis(2-amino-5-tert-butylphenyl)ethane-1,2-dione.
| Compound Name | 1,2-bis(2-amino-5-tert-butylphenyl)ethane-1,2-dione |
|---|---|
| PubChem CID | 141464384 |
| Molecular Formula | C22H28N2O2 |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.22 |
| IUPAC Name | 1,2-bis(2-amino-5-tert-butylphenyl)ethane-1,2-dione |
| SMILES | CC(C)(C)c1ccc(N)c(C(=O)C(=O)c2cc(C(C)(C)C)ccc2N)c1 |
| InChI | InChI=1S/C22H28N2O2/c1-21(2,3)13-7-9-17(23)15(11-13)19(25)20(26)16-12-14(22(4,5)6)8-10-18(16)24/h7-12H,23-24H2,1-6H3 |
| InChIKey | YWFHVDZGVVOSCE-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|