About N-benzyl-9H-pyrido[3,4-b]indol-3-amine
N-benzyl-9H-pyrido[3,4-b]indol-3-amine (PubChem CID 14146439) has the molecular formula C18H15N3
and a molecular weight of 273.34 g/mol. Its IUPAC name is N-benzyl-9H-pyrido[3,4-b]indol-3-amine.
Molecular Properties
| Compound Name | N-benzyl-9H-pyrido[3,4-b]indol-3-amine |
| PubChem CID | 14146439 |
| Molecular Formula | C18H15N3 |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.13 |
| IUPAC Name | N-benzyl-9H-pyrido[3,4-b]indol-3-amine |
| SMILES | c1ccc(CNc2cc3c(cn2)[nH]c2ccccc23)cc1 |
| InChI | InChI=1S/C18H15N3/c1-2-6-13(7-3-1)11-19-18-10-15-14-8-4-5-9-16(14)21-17(15)12-20-18/h1-10,12,21H,11H2,(H,19,20) |
| InChIKey | AMHUWPNOAHGUFX-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-benzyl-9H-pyrido[3,4-b]indol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-9H-pyrido[3,4-b]indol-3-amine?
The IUPAC name of N-benzyl-9H-pyrido[3,4-b]indol-3-amine (CID 14146439) is N-benzyl-9H-pyrido[3,4-b]indol-3-amine.
What is the SMILES notation for N-benzyl-9H-pyrido[3,4-b]indol-3-amine?
The canonical SMILES for N-benzyl-9H-pyrido[3,4-b]indol-3-amine is c1ccc(CNc2cc3c(cn2)[nH]c2ccccc23)cc1.
What is the InChIKey of N-benzyl-9H-pyrido[3,4-b]indol-3-amine?
The InChIKey is AMHUWPNOAHGUFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15N3/c1-2-6-13(7-3-1)11-19-18-10-15-14-8-4-5-9-16(14)21-17(15)12-20-18/h1-10,12,21H,11H2,(H,19,20).
What are the key properties of N-benzyl-9H-pyrido[3,4-b]indol-3-amine?
N-benzyl-9H-pyrido[3,4-b]indol-3-amine has a molecular weight of 273.34 g/mol, XLogP of 4.33, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-9H-pyrido[3,4-b]indol-3-amine is sourced from PubChem (CID 14146439), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).