C29H32Cl2N4O2 — CID 141465396
6-(2,6-dichloro-3,5-dimethoxyphenyl)-3-[1-[4-[(3S,5R)-3,5-dimethylpiperazin-1-yl]phenyl]ethyl]-2H-indazole (PubChem CID 141465396) has the molecular formula C29H32Cl2N4O2 and a molecular weight of 539.51 g/mol. Its IUPAC name is 6-(2,6-dichloro-3,5-dimethoxyphenyl)-3-[1-[4-[(3S,5R)-3,5-dimethylpiperazin-1-yl]phenyl]ethyl]-2H-indazole.
| Compound Name | 6-(2,6-dichloro-3,5-dimethoxyphenyl)-3-[1-[4-[(3S,5R)-3,5-dimethylpiperazin-1-yl]phenyl]ethyl]-2H-indazole |
|---|---|
| PubChem CID | 141465396 |
| Molecular Formula | C29H32Cl2N4O2 |
| Molecular Weight | 539.51 g/mol |
| Exact Mass | 538.19 |
| IUPAC Name | 6-(2,6-dichloro-3,5-dimethoxyphenyl)-3-[1-[4-[(3S,5R)-3,5-dimethylpiperazin-1-yl]phenyl]ethyl]-2H-indazole |
| SMILES | COc1cc(OC)c(Cl)c(-c2ccc3c(C(C)c4ccc(N5C[C@@H](C)N[C@@H](C)C5)cc4)[nH]nc3c2)c1Cl |
| InChI | InChI=1S/C29H32Cl2N4O2/c1-16-14-35(15-17(2)32-16)21-9-6-19(7-10-21)18(3)29-22-11-8-20(12-23(22)33-34-29)26-27(30)24(36-4)13-25(37-5)28(26)31/h6-13,16-18,32H,14-15H2,1-5H3,(H,33,34)/t16-,17+,18? |
| InChIKey | DXXBBNQFLLEVFI-JWTNVVGKSA-N |
| XLogP | 6.89 |
| TPSA | 62.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.51 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|