C24H22N2O6 — CID 141465486
2-oxido-4-(3-phenylmethoxyphenyl)-3-(3,4,5-trimethoxyphenyl)-1,2,5-oxadiazol-2-ium (PubChem CID 141465486) has the molecular formula C24H22N2O6 and a molecular weight of 434.45 g/mol. Its IUPAC name is 2-oxido-4-(3-phenylmethoxyphenyl)-3-(3,4,5-trimethoxyphenyl)-1,2,5-oxadiazol-2-ium.
| Compound Name | 2-oxido-4-(3-phenylmethoxyphenyl)-3-(3,4,5-trimethoxyphenyl)-1,2,5-oxadiazol-2-ium |
|---|---|
| PubChem CID | 141465486 |
| Molecular Formula | C24H22N2O6 |
| Molecular Weight | 434.45 g/mol |
| Exact Mass | 434.15 |
| IUPAC Name | 2-oxido-4-(3-phenylmethoxyphenyl)-3-(3,4,5-trimethoxyphenyl)-1,2,5-oxadiazol-2-ium |
| SMILES | COc1cc(-c2c(-c3cccc(OCc4ccccc4)c3)no[n+]2[O-])cc(OC)c1OC |
| InChI | InChI=1S/C24H22N2O6/c1-28-20-13-18(14-21(29-2)24(20)30-3)23-22(25-32-26(23)27)17-10-7-11-19(12-17)31-15-16-8-5-4-6-9-16/h4-14H,15H2,1-3H3 |
| InChIKey | UURKNOJLHVERCQ-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 89.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.45 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'} |
|---|