About 2-(4-benzylphenyl)-7-prop-2-enoyl-6,8-dihydro-5H-imidazo[1,2-a]pyrazine-3-carboxamide
2-(4-benzylphenyl)-7-prop-2-enoyl-6,8-dihydro-5H-imidazo[1,2-a]pyrazine-3-carboxamide (PubChem CID 141466244) has the molecular formula C23H22N4O2
and a molecular weight of 386.46 g/mol. Its IUPAC name is 2-(4-benzylphenyl)-7-prop-2-enoyl-6,8-dihydro-5H-imidazo[1,2-a]pyrazine-3-carboxamide.
Molecular Properties
| Compound Name | 2-(4-benzylphenyl)-7-prop-2-enoyl-6,8-dihydro-5H-imidazo[1,2-a]pyrazine-3-carboxamide |
| PubChem CID | 141466244 |
| Molecular Formula | C23H22N4O2 |
| Molecular Weight | 386.46 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | 2-(4-benzylphenyl)-7-prop-2-enoyl-6,8-dihydro-5H-imidazo[1,2-a]pyrazine-3-carboxamide |
| SMILES | C=CC(=O)N1CCn2c(nc(-c3ccc(Cc4ccccc4)cc3)c2C(N)=O)C1 |
| InChI | InChI=1S/C23H22N4O2/c1-2-20(28)26-12-13-27-19(15-26)25-21(22(27)23(24)29)18-10-8-17(9-11-18)14-16-6-4-3-5-7-16/h2-11H,1,12-15H2,(H2,24,29) |
| InChIKey | QJSRWJHCSQBGHR-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 81.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.46 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-benzylphenyl)-7-prop-2-enoyl-6,8-dihydro-5H-imidazo[1,2-a]pyrazine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-benzylphenyl)-7-prop-2-enoyl-6,8-dihydro-5H-imidazo[1,2-a]pyrazine-3-carboxamide?
The IUPAC name of 2-(4-benzylphenyl)-7-prop-2-enoyl-6,8-dihydro-5H-imidazo[1,2-a]pyrazine-3-carboxamide (CID 141466244) is 2-(4-benzylphenyl)-7-prop-2-enoyl-6,8-dihydro-5H-imidazo[1,2-a]pyrazine-3-carboxamide.
What is the SMILES notation for 2-(4-benzylphenyl)-7-prop-2-enoyl-6,8-dihydro-5H-imidazo[1,2-a]pyrazine-3-carboxamide?
The canonical SMILES for 2-(4-benzylphenyl)-7-prop-2-enoyl-6,8-dihydro-5H-imidazo[1,2-a]pyrazine-3-carboxamide is C=CC(=O)N1CCn2c(nc(-c3ccc(Cc4ccccc4)cc3)c2C(N)=O)C1.
What is the InChIKey of 2-(4-benzylphenyl)-7-prop-2-enoyl-6,8-dihydro-5H-imidazo[1,2-a]pyrazine-3-carboxamide?
The InChIKey is QJSRWJHCSQBGHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H22N4O2/c1-2-20(28)26-12-13-27-19(15-26)25-21(22(27)23(24)29)18-10-8-17(9-11-18)14-16-6-4-3-5-7-16/h2-11H,1,12-15H2,(H2,24,29).
What are the key properties of 2-(4-benzylphenyl)-7-prop-2-enoyl-6,8-dihydro-5H-imidazo[1,2-a]pyrazine-3-carboxamide?
2-(4-benzylphenyl)-7-prop-2-enoyl-6,8-dihydro-5H-imidazo[1,2-a]pyrazine-3-carboxamide has a molecular weight of 386.46 g/mol, XLogP of 2.77, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-benzylphenyl)-7-prop-2-enoyl-6,8-dihydro-5H-imidazo[1,2-a]pyrazine-3-carboxamide is sourced from PubChem (CID 141466244), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).