C18H21ClFNO3S — CID 141466492
(1R,2S)-2-[chloro-[(1S)-1-phenylethyl]amino]-3-fluoro-1-(4-methylsulfonylphenyl)propan-1-ol (PubChem CID 141466492) has the molecular formula C18H21ClFNO3S and a molecular weight of 385.89 g/mol. Its IUPAC name is (1R,2S)-2-[chloro-[(1S)-1-phenylethyl]amino]-3-fluoro-1-(4-methylsulfonylphenyl)propan-1-ol.
| Compound Name | (1R,2S)-2-[chloro-[(1S)-1-phenylethyl]amino]-3-fluoro-1-(4-methylsulfonylphenyl)propan-1-ol |
|---|---|
| PubChem CID | 141466492 |
| Molecular Formula | C18H21ClFNO3S |
| Molecular Weight | 385.89 g/mol |
| Exact Mass | 385.09 |
| IUPAC Name | (1R,2S)-2-[chloro-[(1S)-1-phenylethyl]amino]-3-fluoro-1-(4-methylsulfonylphenyl)propan-1-ol |
| SMILES | C[C@@H](c1ccccc1)N(Cl)[C@H](CF)[C@H](O)c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C18H21ClFNO3S/c1-13(14-6-4-3-5-7-14)21(19)17(12-20)18(22)15-8-10-16(11-9-15)25(2,23)24/h3-11,13,17-18,22H,12H2,1-2H3/t13-,17+,18+/m0/s1 |
| InChIKey | WAUKWWLLSDTSBX-MORSLUCNSA-N |
| XLogP | 3.68 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.89 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|