C18H18F6N4O4 — CID 141466546
[2-[3-[4-[2-(trifluoromethoxy)phenyl]piperidin-1-yl]-1,2,4-oxadiazol-5-yl]ethylamino] 2,2,2-trifluoroacetate (PubChem CID 141466546) has the molecular formula C18H18F6N4O4 and a molecular weight of 468.35 g/mol. Its IUPAC name is [2-[3-[4-[2-(trifluoromethoxy)phenyl]piperidin-1-yl]-1,2,4-oxadiazol-5-yl]ethylamino] 2,2,2-trifluoroacetate.
| Compound Name | [2-[3-[4-[2-(trifluoromethoxy)phenyl]piperidin-1-yl]-1,2,4-oxadiazol-5-yl]ethylamino] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 141466546 |
| Molecular Formula | C18H18F6N4O4 |
| Molecular Weight | 468.35 g/mol |
| Exact Mass | 468.12 |
| IUPAC Name | [2-[3-[4-[2-(trifluoromethoxy)phenyl]piperidin-1-yl]-1,2,4-oxadiazol-5-yl]ethylamino] 2,2,2-trifluoroacetate |
| SMILES | O=C(ONCCc1nc(N2CCC(c3ccccc3OC(F)(F)F)CC2)no1)C(F)(F)F |
| InChI | InChI=1S/C18H18F6N4O4/c19-17(20,21)15(29)32-25-8-5-14-26-16(27-31-14)28-9-6-11(7-10-28)12-3-1-2-4-13(12)30-18(22,23)24/h1-4,11,25H,5-10H2 |
| InChIKey | NNPMVEIHZJDZOG-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 89.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.35 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|