C18H15N7 — CID 141466979
2-[4-[2-(1-methylpyrazol-4-yl)-5H-pyrrolo[2,3-b]pyrazin-7-yl]anilino]acetonitrile (PubChem CID 141466979) has the molecular formula C18H15N7 and a molecular weight of 329.37 g/mol. Its IUPAC name is 2-[4-[2-(1-methylpyrazol-4-yl)-5H-pyrrolo[2,3-b]pyrazin-7-yl]anilino]acetonitrile.
| Compound Name | 2-[4-[2-(1-methylpyrazol-4-yl)-5H-pyrrolo[2,3-b]pyrazin-7-yl]anilino]acetonitrile |
|---|---|
| PubChem CID | 141466979 |
| Molecular Formula | C18H15N7 |
| Molecular Weight | 329.37 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | 2-[4-[2-(1-methylpyrazol-4-yl)-5H-pyrrolo[2,3-b]pyrazin-7-yl]anilino]acetonitrile |
| SMILES | Cn1cc(-c2cnc3[nH]cc(-c4ccc(NCC#N)cc4)c3n2)cn1 |
| InChI | InChI=1S/C18H15N7/c1-25-11-13(8-23-25)16-10-22-18-17(24-16)15(9-21-18)12-2-4-14(5-3-12)20-7-6-19/h2-5,8-11,20H,7H2,1H3,(H,21,22) |
| InChIKey | WTLQFBHBKBZRHZ-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 95.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.37 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|