About 3-methyl-8,9-dihydro-6H-pyrrolo[3,2-f]quinolin-7-one
3-methyl-8,9-dihydro-6H-pyrrolo[3,2-f]quinolin-7-one (PubChem CID 141467140) has the molecular formula C12H12N2O
and a molecular weight of 200.24 g/mol. Its IUPAC name is 3-methyl-8,9-dihydro-6H-pyrrolo[3,2-f]quinolin-7-one.
Molecular Properties
| Compound Name | 3-methyl-8,9-dihydro-6H-pyrrolo[3,2-f]quinolin-7-one |
| PubChem CID | 141467140 |
| Molecular Formula | C12H12N2O |
| Molecular Weight | 200.24 g/mol |
| Exact Mass | 200.09 |
| IUPAC Name | 3-methyl-8,9-dihydro-6H-pyrrolo[3,2-f]quinolin-7-one |
| SMILES | Cn1ccc2c3c(ccc21)NC(=O)CC3 |
| InChI | InChI=1S/C12H12N2O/c1-14-7-6-9-8-2-5-12(15)13-10(8)3-4-11(9)14/h3-4,6-7H,2,5H2,1H3,(H,13,15) |
| InChIKey | JRFJOEFWAPBXJQ-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.24 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-methyl-8,9-dihydro-6H-pyrrolo[3,2-f]quinolin-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-8,9-dihydro-6H-pyrrolo[3,2-f]quinolin-7-one?
The IUPAC name of 3-methyl-8,9-dihydro-6H-pyrrolo[3,2-f]quinolin-7-one (CID 141467140) is 3-methyl-8,9-dihydro-6H-pyrrolo[3,2-f]quinolin-7-one.
What is the SMILES notation for 3-methyl-8,9-dihydro-6H-pyrrolo[3,2-f]quinolin-7-one?
The canonical SMILES for 3-methyl-8,9-dihydro-6H-pyrrolo[3,2-f]quinolin-7-one is Cn1ccc2c3c(ccc21)NC(=O)CC3.
What is the InChIKey of 3-methyl-8,9-dihydro-6H-pyrrolo[3,2-f]quinolin-7-one?
The InChIKey is JRFJOEFWAPBXJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N2O/c1-14-7-6-9-8-2-5-12(15)13-10(8)3-4-11(9)14/h3-4,6-7H,2,5H2,1H3,(H,13,15).
What are the key properties of 3-methyl-8,9-dihydro-6H-pyrrolo[3,2-f]quinolin-7-one?
3-methyl-8,9-dihydro-6H-pyrrolo[3,2-f]quinolin-7-one has a molecular weight of 200.24 g/mol, XLogP of 2.06, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-8,9-dihydro-6H-pyrrolo[3,2-f]quinolin-7-one is sourced from PubChem (CID 141467140), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).