C17H12I3N3O8 — CID 141467535
5-amino-2,4,6-triiodo-3-N-methyl-1-N,3-N-bis[(2-oxo-1,3-dioxol-4-yl)methyl]benzene-1,3-dicarboxamide (PubChem CID 141467535) has the molecular formula C17H12I3N3O8 and a molecular weight of 767.01 g/mol. Its IUPAC name is 5-amino-2,4,6-triiodo-3-N-methyl-1-N,3-N-bis[(2-oxo-1,3-dioxol-4-yl)methyl]benzene-1,3-dicarboxamide.
| Compound Name | 5-amino-2,4,6-triiodo-3-N-methyl-1-N,3-N-bis[(2-oxo-1,3-dioxol-4-yl)methyl]benzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 141467535 |
| Molecular Formula | C17H12I3N3O8 |
| Molecular Weight | 767.01 g/mol |
| Exact Mass | 766.78 |
| IUPAC Name | 5-amino-2,4,6-triiodo-3-N-methyl-1-N,3-N-bis[(2-oxo-1,3-dioxol-4-yl)methyl]benzene-1,3-dicarboxamide |
| SMILES | CN(Cc1coc(=O)o1)C(=O)c1c(I)c(N)c(I)c(C(=O)NCc2coc(=O)o2)c1I |
| InChI | InChI=1S/C17H12I3N3O8/c1-23(3-7-5-29-17(27)31-7)15(25)9-10(18)8(11(19)13(21)12(9)20)14(24)22-2-6-4-28-16(26)30-6/h4-5H,2-3,21H2,1H3,(H,22,24) |
| InChIKey | VYDAZSYZIDFXDE-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 162.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 767.01 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|