C19H31NO3 — CID 141468027
tert-butyl N-(2-methylprop-2-enoyl)-N-(3,4,4-trimethyl-2-methylidenecyclohexyl)carbamate (PubChem CID 141468027) has the molecular formula C19H31NO3 and a molecular weight of 321.46 g/mol. Its IUPAC name is tert-butyl N-(2-methylprop-2-enoyl)-N-(3,4,4-trimethyl-2-methylidenecyclohexyl)carbamate.
| Compound Name | tert-butyl N-(2-methylprop-2-enoyl)-N-(3,4,4-trimethyl-2-methylidenecyclohexyl)carbamate |
|---|---|
| PubChem CID | 141468027 |
| Molecular Formula | C19H31NO3 |
| Molecular Weight | 321.46 g/mol |
| Exact Mass | 321.23 |
| IUPAC Name | tert-butyl N-(2-methylprop-2-enoyl)-N-(3,4,4-trimethyl-2-methylidenecyclohexyl)carbamate |
| SMILES | C=C(C)C(=O)N(C(=O)OC(C)(C)C)C1CCC(C)(C)C(C)C1=C |
| InChI | InChI=1S/C19H31NO3/c1-12(2)16(21)20(17(22)23-18(5,6)7)15-10-11-19(8,9)14(4)13(15)3/h14-15H,1,3,10-11H2,2,4-9H3 |
| InChIKey | DQFBIRFPDRFSGS-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.46 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|