About cyclohexyl-[(2R,6R)-6-methylmorpholin-2-yl]methanone
cyclohexyl-[(2R,6R)-6-methylmorpholin-2-yl]methanone (PubChem CID 141468105) has the molecular formula C12H21NO2
and a molecular weight of 211.30 g/mol. Its IUPAC name is cyclohexyl-[(2R,6R)-6-methylmorpholin-2-yl]methanone.
Molecular Properties
| Compound Name | cyclohexyl-[(2R,6R)-6-methylmorpholin-2-yl]methanone |
| PubChem CID | 141468105 |
| Molecular Formula | C12H21NO2 |
| Molecular Weight | 211.30 g/mol |
| Exact Mass | 211.16 |
| IUPAC Name | cyclohexyl-[(2R,6R)-6-methylmorpholin-2-yl]methanone |
| SMILES | C[C@@H]1CNC[C@H](C(=O)C2CCCCC2)O1 |
| InChI | InChI=1S/C12H21NO2/c1-9-7-13-8-11(15-9)12(14)10-5-3-2-4-6-10/h9-11,13H,2-8H2,1H3/t9-,11-/m1/s1 |
| InChIKey | ICVZLKUEMAPQLN-MWLCHTKSSA-N |
| XLogP | 1.51 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.30 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze cyclohexyl-[(2R,6R)-6-methylmorpholin-2-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexyl-[(2R,6R)-6-methylmorpholin-2-yl]methanone?
The IUPAC name of cyclohexyl-[(2R,6R)-6-methylmorpholin-2-yl]methanone (CID 141468105) is cyclohexyl-[(2R,6R)-6-methylmorpholin-2-yl]methanone.
What is the SMILES notation for cyclohexyl-[(2R,6R)-6-methylmorpholin-2-yl]methanone?
The canonical SMILES for cyclohexyl-[(2R,6R)-6-methylmorpholin-2-yl]methanone is C[C@@H]1CNC[C@H](C(=O)C2CCCCC2)O1.
What is the InChIKey of cyclohexyl-[(2R,6R)-6-methylmorpholin-2-yl]methanone?
The InChIKey is ICVZLKUEMAPQLN-MWLCHTKSSA-N. The full InChI is InChI=1S/C12H21NO2/c1-9-7-13-8-11(15-9)12(14)10-5-3-2-4-6-10/h9-11,13H,2-8H2,1H3/t9-,11-/m1/s1.
What are the key properties of cyclohexyl-[(2R,6R)-6-methylmorpholin-2-yl]methanone?
cyclohexyl-[(2R,6R)-6-methylmorpholin-2-yl]methanone has a molecular weight of 211.30 g/mol, XLogP of 1.51, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexyl-[(2R,6R)-6-methylmorpholin-2-yl]methanone is sourced from PubChem (CID 141468105), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).