C12H21N3O2 — CID 141468230
2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl-[(2R,6R)-6-methylmorpholin-2-yl]methanone (PubChem CID 141468230) has the molecular formula C12H21N3O2 and a molecular weight of 239.32 g/mol. Its IUPAC name is 2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl-[(2R,6R)-6-methylmorpholin-2-yl]methanone.
| Compound Name | 2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl-[(2R,6R)-6-methylmorpholin-2-yl]methanone |
|---|---|
| PubChem CID | 141468230 |
| Molecular Formula | C12H21N3O2 |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.16 |
| IUPAC Name | 2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl-[(2R,6R)-6-methylmorpholin-2-yl]methanone |
| SMILES | C[C@@H]1CNC[C@H](C(=O)N2CC3CNCC3C2)O1 |
| InChI | InChI=1S/C12H21N3O2/c1-8-2-13-5-11(17-8)12(16)15-6-9-3-14-4-10(9)7-15/h8-11,13-14H,2-7H2,1H3/t8-,9?,10?,11-/m1/s1 |
| InChIKey | NXHVIAZZEKYMFX-AGVGLQIMSA-N |
| XLogP | -0.96 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |