About 1,2-dimethyl-N-[[(2S,6R)-6-methylmorpholin-2-yl]methyl]benzimidazol-5-amine
1,2-dimethyl-N-[[(2S,6R)-6-methylmorpholin-2-yl]methyl]benzimidazol-5-amine (PubChem CID 141468247) has the molecular formula C15H22N4O
and a molecular weight of 274.37 g/mol. Its IUPAC name is 1,2-dimethyl-N-[[(2S,6R)-6-methylmorpholin-2-yl]methyl]benzimidazol-5-amine.
Molecular Properties
| Compound Name | 1,2-dimethyl-N-[[(2S,6R)-6-methylmorpholin-2-yl]methyl]benzimidazol-5-amine |
| PubChem CID | 141468247 |
| Molecular Formula | C15H22N4O |
| Molecular Weight | 274.37 g/mol |
| Exact Mass | 274.18 |
| IUPAC Name | 1,2-dimethyl-N-[[(2S,6R)-6-methylmorpholin-2-yl]methyl]benzimidazol-5-amine |
| SMILES | Cc1nc2cc(NC[C@@H]3CNC[C@@H](C)O3)ccc2n1C |
| InChI | InChI=1S/C15H22N4O/c1-10-7-16-8-13(20-10)9-17-12-4-5-15-14(6-12)18-11(2)19(15)3/h4-6,10,13,16-17H,7-9H2,1-3H3/t10-,13+/m1/s1 |
| InChIKey | BNVGIHSVHXCBGF-MFKMUULPSA-N |
| XLogP | 1.67 |
| TPSA | 51.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.37 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1,2-dimethyl-N-[[(2S,6R)-6-methylmorpholin-2-yl]methyl]benzimidazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dimethyl-N-[[(2S,6R)-6-methylmorpholin-2-yl]methyl]benzimidazol-5-amine?
The IUPAC name of 1,2-dimethyl-N-[[(2S,6R)-6-methylmorpholin-2-yl]methyl]benzimidazol-5-amine (CID 141468247) is 1,2-dimethyl-N-[[(2S,6R)-6-methylmorpholin-2-yl]methyl]benzimidazol-5-amine.
What is the SMILES notation for 1,2-dimethyl-N-[[(2S,6R)-6-methylmorpholin-2-yl]methyl]benzimidazol-5-amine?
The canonical SMILES for 1,2-dimethyl-N-[[(2S,6R)-6-methylmorpholin-2-yl]methyl]benzimidazol-5-amine is Cc1nc2cc(NC[C@@H]3CNC[C@@H](C)O3)ccc2n1C.
What is the InChIKey of 1,2-dimethyl-N-[[(2S,6R)-6-methylmorpholin-2-yl]methyl]benzimidazol-5-amine?
The InChIKey is BNVGIHSVHXCBGF-MFKMUULPSA-N. The full InChI is InChI=1S/C15H22N4O/c1-10-7-16-8-13(20-10)9-17-12-4-5-15-14(6-12)18-11(2)19(15)3/h4-6,10,13,16-17H,7-9H2,1-3H3/t10-,13+/m1/s1.
What are the key properties of 1,2-dimethyl-N-[[(2S,6R)-6-methylmorpholin-2-yl]methyl]benzimidazol-5-amine?
1,2-dimethyl-N-[[(2S,6R)-6-methylmorpholin-2-yl]methyl]benzimidazol-5-amine has a molecular weight of 274.37 g/mol, XLogP of 1.67, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dimethyl-N-[[(2S,6R)-6-methylmorpholin-2-yl]methyl]benzimidazol-5-amine is sourced from PubChem (CID 141468247), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).