About 3,3-dimethyl-1-(5-methylpyrazin-2-yl)-6-(6-methyl-3-pyridinyl)-3a,4-dihydroindol-2-one
3,3-dimethyl-1-(5-methylpyrazin-2-yl)-6-(6-methyl-3-pyridinyl)-3a,4-dihydroindol-2-one (PubChem CID 141468890) has the molecular formula C21H22N4O
and a molecular weight of 346.43 g/mol. Its IUPAC name is 3,3-dimethyl-1-(5-methylpyrazin-2-yl)-6-(6-methyl-3-pyridinyl)-3a,4-dihydroindol-2-one.
Molecular Properties
| Compound Name | 3,3-dimethyl-1-(5-methylpyrazin-2-yl)-6-(6-methyl-3-pyridinyl)-3a,4-dihydroindol-2-one |
| PubChem CID | 141468890 |
| Molecular Formula | C21H22N4O |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | 3,3-dimethyl-1-(5-methylpyrazin-2-yl)-6-(6-methyl-3-pyridinyl)-3a,4-dihydroindol-2-one |
| SMILES | Cc1ccc(C2=CCC3C(=C2)N(c2cnc(C)cn2)C(=O)C3(C)C)cn1 |
| InChI | InChI=1S/C21H22N4O/c1-13-5-6-16(11-22-13)15-7-8-17-18(9-15)25(20(26)21(17,3)4)19-12-23-14(2)10-24-19/h5-7,9-12,17H,8H2,1-4H3 |
| InChIKey | DOPJAYYCIWMCLA-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 58.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3,3-dimethyl-1-(5-methylpyrazin-2-yl)-6-(6-methyl-3-pyridinyl)-3a,4-dihydroindol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-dimethyl-1-(5-methylpyrazin-2-yl)-6-(6-methyl-3-pyridinyl)-3a,4-dihydroindol-2-one?
The IUPAC name of 3,3-dimethyl-1-(5-methylpyrazin-2-yl)-6-(6-methyl-3-pyridinyl)-3a,4-dihydroindol-2-one (CID 141468890) is 3,3-dimethyl-1-(5-methylpyrazin-2-yl)-6-(6-methyl-3-pyridinyl)-3a,4-dihydroindol-2-one.
What is the SMILES notation for 3,3-dimethyl-1-(5-methylpyrazin-2-yl)-6-(6-methyl-3-pyridinyl)-3a,4-dihydroindol-2-one?
The canonical SMILES for 3,3-dimethyl-1-(5-methylpyrazin-2-yl)-6-(6-methyl-3-pyridinyl)-3a,4-dihydroindol-2-one is Cc1ccc(C2=CCC3C(=C2)N(c2cnc(C)cn2)C(=O)C3(C)C)cn1.
What is the InChIKey of 3,3-dimethyl-1-(5-methylpyrazin-2-yl)-6-(6-methyl-3-pyridinyl)-3a,4-dihydroindol-2-one?
The InChIKey is DOPJAYYCIWMCLA-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H22N4O/c1-13-5-6-16(11-22-13)15-7-8-17-18(9-15)25(20(26)21(17,3)4)19-12-23-14(2)10-24-19/h5-7,9-12,17H,8H2,1-4H3.
What are the key properties of 3,3-dimethyl-1-(5-methylpyrazin-2-yl)-6-(6-methyl-3-pyridinyl)-3a,4-dihydroindol-2-one?
3,3-dimethyl-1-(5-methylpyrazin-2-yl)-6-(6-methyl-3-pyridinyl)-3a,4-dihydroindol-2-one has a molecular weight of 346.43 g/mol, XLogP of 3.85, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-dimethyl-1-(5-methylpyrazin-2-yl)-6-(6-methyl-3-pyridinyl)-3a,4-dihydroindol-2-one is sourced from PubChem (CID 141468890), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).