C24H31ClFN3O5 — CID 141469213
tert-butyl (2S,3S)-2-[(4-amino-5-chloro-2-ethoxybenzoyl)amino]-3-[(4-fluorophenyl)methyl-hydroxyamino]butanoate (PubChem CID 141469213) has the molecular formula C24H31ClFN3O5 and a molecular weight of 495.98 g/mol. Its IUPAC name is tert-butyl (2S,3S)-2-[(4-amino-5-chloro-2-ethoxybenzoyl)amino]-3-[(4-fluorophenyl)methyl-hydroxyamino]butanoate.
| Compound Name | tert-butyl (2S,3S)-2-[(4-amino-5-chloro-2-ethoxybenzoyl)amino]-3-[(4-fluorophenyl)methyl-hydroxyamino]butanoate |
|---|---|
| PubChem CID | 141469213 |
| Molecular Formula | C24H31ClFN3O5 |
| Molecular Weight | 495.98 g/mol |
| Exact Mass | 495.19 |
| IUPAC Name | tert-butyl (2S,3S)-2-[(4-amino-5-chloro-2-ethoxybenzoyl)amino]-3-[(4-fluorophenyl)methyl-hydroxyamino]butanoate |
| SMILES | CCOc1cc(N)c(Cl)cc1C(=O)N[C@H](C(=O)OC(C)(C)C)[C@H](C)N(O)Cc1ccc(F)cc1 |
| InChI | InChI=1S/C24H31ClFN3O5/c1-6-33-20-12-19(27)18(25)11-17(20)22(30)28-21(23(31)34-24(3,4)5)14(2)29(32)13-15-7-9-16(26)10-8-15/h7-12,14,21,32H,6,13,27H2,1-5H3,(H,28,30)/t14-,21-/m0/s1 |
| InChIKey | PIGQFNDCMLQRID-QKKBWIMNSA-N |
| XLogP | 4.18 |
| TPSA | 114.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.98 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|