C39H38N4O7 — CID 141469296
4-[[(2S,6R)-6-(4-benzamido-2-hydroxy-2H-pyrimidin-1-yl)-4-tritylmorpholin-2-yl]methoxy]-4-oxobutanoic acid (PubChem CID 141469296) has the molecular formula C39H38N4O7 and a molecular weight of 674.75 g/mol. Its IUPAC name is 4-[[(2S,6R)-6-(4-benzamido-2-hydroxy-2H-pyrimidin-1-yl)-4-tritylmorpholin-2-yl]methoxy]-4-oxobutanoic acid.
| Compound Name | 4-[[(2S,6R)-6-(4-benzamido-2-hydroxy-2H-pyrimidin-1-yl)-4-tritylmorpholin-2-yl]methoxy]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 141469296 |
| Molecular Formula | C39H38N4O7 |
| Molecular Weight | 674.75 g/mol |
| Exact Mass | 674.27 |
| IUPAC Name | 4-[[(2S,6R)-6-(4-benzamido-2-hydroxy-2H-pyrimidin-1-yl)-4-tritylmorpholin-2-yl]methoxy]-4-oxobutanoic acid |
| SMILES | O=C(O)CCC(=O)OC[C@@H]1CN(C(c2ccccc2)(c2ccccc2)c2ccccc2)C[C@H](N2C=CC(NC(=O)c3ccccc3)=NC2O)O1 |
| InChI | InChI=1S/C39H38N4O7/c44-35(45)21-22-36(46)49-27-32-25-42(26-34(50-32)43-24-23-33(41-38(43)48)40-37(47)28-13-5-1-6-14-28)39(29-15-7-2-8-16-29,30-17-9-3-10-18-30)31-19-11-4-12-20-31/h1-20,23-24,32,34,38,48H,21-22,25-27H2,(H,44,45)(H,40,41,47)/t32-,34+,38?/m0/s1 |
| InChIKey | FADZJECEUOGZEG-VBQKXNQLSA-N |
| XLogP | 4.35 |
| TPSA | 141.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 50 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.75 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|