About 7-propyl-2,4-dihydro-1,5-benzodiazepin-3-one
7-propyl-2,4-dihydro-1,5-benzodiazepin-3-one (PubChem CID 141469693) has the molecular formula C12H14N2O
and a molecular weight of 202.26 g/mol. Its IUPAC name is 7-propyl-2,4-dihydro-1,5-benzodiazepin-3-one.
Molecular Properties
| Compound Name | 7-propyl-2,4-dihydro-1,5-benzodiazepin-3-one |
| PubChem CID | 141469693 |
| Molecular Formula | C12H14N2O |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.11 |
| IUPAC Name | 7-propyl-2,4-dihydro-1,5-benzodiazepin-3-one |
| SMILES | CCCc1ccc2c(c1)=NCC(=O)CN=2 |
| InChI | InChI=1S/C12H14N2O/c1-2-3-9-4-5-11-12(6-9)14-8-10(15)7-13-11/h4-6H,2-3,7-8H2,1H3 |
| InChIKey | DGZFLRWNYAETPX-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 41.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-propyl-2,4-dihydro-1,5-benzodiazepin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-propyl-2,4-dihydro-1,5-benzodiazepin-3-one?
The IUPAC name of 7-propyl-2,4-dihydro-1,5-benzodiazepin-3-one (CID 141469693) is 7-propyl-2,4-dihydro-1,5-benzodiazepin-3-one.
What is the SMILES notation for 7-propyl-2,4-dihydro-1,5-benzodiazepin-3-one?
The canonical SMILES for 7-propyl-2,4-dihydro-1,5-benzodiazepin-3-one is CCCc1ccc2c(c1)=NCC(=O)CN=2.
What is the InChIKey of 7-propyl-2,4-dihydro-1,5-benzodiazepin-3-one?
The InChIKey is DGZFLRWNYAETPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N2O/c1-2-3-9-4-5-11-12(6-9)14-8-10(15)7-13-11/h4-6H,2-3,7-8H2,1H3.
What are the key properties of 7-propyl-2,4-dihydro-1,5-benzodiazepin-3-one?
7-propyl-2,4-dihydro-1,5-benzodiazepin-3-one has a molecular weight of 202.26 g/mol, XLogP of 0.46, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-propyl-2,4-dihydro-1,5-benzodiazepin-3-one is sourced from PubChem (CID 141469693), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).