C10H19NO2 — CID 141470021
(7R,7aS)-7-(methoxymethyl)-3,3-dimethyl-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazole (PubChem CID 141470021) has the molecular formula C10H19NO2 and a molecular weight of 185.27 g/mol. Its IUPAC name is (7R,7aS)-7-(methoxymethyl)-3,3-dimethyl-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazole.
| Compound Name | (7R,7aS)-7-(methoxymethyl)-3,3-dimethyl-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazole |
|---|---|
| PubChem CID | 141470021 |
| Molecular Formula | C10H19NO2 |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.14 |
| IUPAC Name | (7R,7aS)-7-(methoxymethyl)-3,3-dimethyl-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazole |
| SMILES | COC[C@@H]1CCN2[C@@H]1COC2(C)C |
| InChI | InChI=1S/C10H19NO2/c1-10(2)11-5-4-8(6-12-3)9(11)7-13-10/h8-9H,4-7H2,1-3H3/t8-,9+/m0/s1 |
| InChIKey | DIESTKBKCRMBOM-DTWKUNHWSA-N |
| XLogP | 1.09 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |