C10H20N2O — CID 141470042
(7R,7aS)-7-ethyl-3,3-dimethyl-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-6-amine (PubChem CID 141470042) has the molecular formula C10H20N2O and a molecular weight of 184.28 g/mol. Its IUPAC name is (7R,7aS)-7-ethyl-3,3-dimethyl-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-6-amine.
| Compound Name | (7R,7aS)-7-ethyl-3,3-dimethyl-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-6-amine |
|---|---|
| PubChem CID | 141470042 |
| Molecular Formula | C10H20N2O |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.16 |
| IUPAC Name | (7R,7aS)-7-ethyl-3,3-dimethyl-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-6-amine |
| SMILES | CC[C@@H]1C(N)CN2[C@@H]1COC2(C)C |
| InChI | InChI=1S/C10H20N2O/c1-4-7-8(11)5-12-9(7)6-13-10(12,2)3/h7-9H,4-6,11H2,1-3H3/t7-,8?,9-/m1/s1 |
| InChIKey | KANSJNBBLOFMSY-PSGOWDBMSA-N |
| XLogP | 0.79 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |