C17H25FN2O2 — CID 141470830
2-fluoro-N'-hydroxy-4-[(R)-hydroxy-[(1R,6S)-2,2,6-trimethylcyclohexyl]methyl]benzenecarboximidamide (PubChem CID 141470830) has the molecular formula C17H25FN2O2 and a molecular weight of 308.40 g/mol. Its IUPAC name is 2-fluoro-N'-hydroxy-4-[(R)-hydroxy-[(1R,6S)-2,2,6-trimethylcyclohexyl]methyl]benzenecarboximidamide.
| Compound Name | 2-fluoro-N'-hydroxy-4-[(R)-hydroxy-[(1R,6S)-2,2,6-trimethylcyclohexyl]methyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 141470830 |
| Molecular Formula | C17H25FN2O2 |
| Molecular Weight | 308.40 g/mol |
| Exact Mass | 308.19 |
| IUPAC Name | 2-fluoro-N'-hydroxy-4-[(R)-hydroxy-[(1R,6S)-2,2,6-trimethylcyclohexyl]methyl]benzenecarboximidamide |
| SMILES | C[C@H]1CCCC(C)(C)[C@@H]1[C@@H](O)c1ccc(C(N)=NO)c(F)c1 |
| InChI | InChI=1S/C17H25FN2O2/c1-10-5-4-8-17(2,3)14(10)15(21)11-6-7-12(13(18)9-11)16(19)20-22/h6-7,9-10,14-15,21-22H,4-5,8H2,1-3H3,(H2,19,20)/t10-,14-,15-/m0/s1 |
| InChIKey | KCZSUPMMYAIMQD-LKTVYLICSA-N |
| XLogP | 3.42 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.40 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|