C10H7F5O2S — CID 141470849
5-ethynyl-5-(1,1,2,2,2-pentafluoroethylsulfonyl)cyclohexa-1,3-diene (PubChem CID 141470849) has the molecular formula C10H7F5O2S and a molecular weight of 286.22 g/mol. Its IUPAC name is 5-ethynyl-5-(1,1,2,2,2-pentafluoroethylsulfonyl)cyclohexa-1,3-diene.
| Compound Name | 5-ethynyl-5-(1,1,2,2,2-pentafluoroethylsulfonyl)cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 141470849 |
| Molecular Formula | C10H7F5O2S |
| Molecular Weight | 286.22 g/mol |
| Exact Mass | 286.01 |
| IUPAC Name | 5-ethynyl-5-(1,1,2,2,2-pentafluoroethylsulfonyl)cyclohexa-1,3-diene |
| SMILES | C#CC1(S(=O)(=O)C(F)(F)C(F)(F)F)C=CC=CC1 |
| InChI | InChI=1S/C10H7F5O2S/c1-2-8(6-4-3-5-7-8)18(16,17)10(14,15)9(11,12)13/h1,3-6H,7H2 |
| InChIKey | XPOIDYFIVYLSSW-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.22 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|