C17H15BrN2 — CID 141471214
3-(4-bromophenyl)-4,4-dimethyl-5-phenylpyrazole (PubChem CID 141471214) has the molecular formula C17H15BrN2 and a molecular weight of 327.23 g/mol. Its IUPAC name is 3-(4-bromophenyl)-4,4-dimethyl-5-phenylpyrazole.
| Compound Name | 3-(4-bromophenyl)-4,4-dimethyl-5-phenylpyrazole |
|---|---|
| PubChem CID | 141471214 |
| Molecular Formula | C17H15BrN2 |
| Molecular Weight | 327.23 g/mol |
| Exact Mass | 326.04 |
| IUPAC Name | 3-(4-bromophenyl)-4,4-dimethyl-5-phenylpyrazole |
| SMILES | CC1(C)C(c2ccccc2)=NN=C1c1ccc(Br)cc1 |
| InChI | InChI=1S/C17H15BrN2/c1-17(2)15(12-6-4-3-5-7-12)19-20-16(17)13-8-10-14(18)11-9-13/h3-11H,1-2H3 |
| InChIKey | LTKKMFMNDMQWAZ-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.23 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |