C14H8N2O3 — CID 141471637
9-oxa-2,3-diazatricyclo[9.2.2.24,7]heptadeca-1(14),2,4,6,11(15),12,16-heptaene-8,10-dione (PubChem CID 141471637) has the molecular formula C14H8N2O3 and a molecular weight of 252.23 g/mol. Its IUPAC name is 9-oxa-2,3-diazatricyclo[9.2.2.24,7]heptadeca-1(14),2,4,6,11(15),12,16-heptaene-8,10-dione.
| Compound Name | 9-oxa-2,3-diazatricyclo[9.2.2.24,7]heptadeca-1(14),2,4,6,11(15),12,16-heptaene-8,10-dione |
|---|---|
| PubChem CID | 141471637 |
| Molecular Formula | C14H8N2O3 |
| Molecular Weight | 252.23 g/mol |
| Exact Mass | 252.05 |
| IUPAC Name | 9-oxa-2,3-diazatricyclo[9.2.2.24,7]heptadeca-1(14),2,4,6,11(15),12,16-heptaene-8,10-dione |
| SMILES | O=C1OC(=O)c2ccc(cc2)/N=N\c2ccc1cc2 |
| InChI | InChI=1S/C14H8N2O3/c17-13-9-1-5-11(6-2-9)15-16-12-7-3-10(4-8-12)14(18)19-13/h1-8H/b16-15- |
| InChIKey | RUOIZUKIBIYVOR-NXVVXOECSA-N |
| XLogP | 3.41 |
| TPSA | 68.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.23 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|