About nitric hydrazide;hydrate
nitric hydrazide;hydrate (PubChem CID 141472933) has the molecular formula H5N3O3
and a molecular weight of 95.06 g/mol. Its IUPAC name is nitric hydrazide;hydrate.
Molecular Properties
| Compound Name | nitric hydrazide;hydrate |
| PubChem CID | 141472933 |
| Molecular Formula | H5N3O3 |
| Molecular Weight | 95.06 g/mol |
| Exact Mass | 95.03 |
| IUPAC Name | nitric hydrazide;hydrate |
| SMILES | NN[N+](=O)[O-].O |
| InChI | InChI=1S/H3N3O2.H2O/c1-2-3(4)5;/h2H,1H2;1H2 |
| InChIKey | GFGXDVHABNQPRB-UHFFFAOYSA-N |
| XLogP | -2.18 |
| TPSA | 112.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 95.06 |
| LogP ≤ 5 | -2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze nitric hydrazide;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of nitric hydrazide;hydrate?
The IUPAC name of nitric hydrazide;hydrate (CID 141472933) is nitric hydrazide;hydrate.
What is the SMILES notation for nitric hydrazide;hydrate?
The canonical SMILES for nitric hydrazide;hydrate is NN[N+](=O)[O-].O.
What is the InChIKey of nitric hydrazide;hydrate?
The InChIKey is GFGXDVHABNQPRB-UHFFFAOYSA-N. The full InChI is InChI=1S/H3N3O2.H2O/c1-2-3(4)5;/h2H,1H2;1H2.
What are the key properties of nitric hydrazide;hydrate?
nitric hydrazide;hydrate has a molecular weight of 95.06 g/mol, XLogP of -2.18, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for nitric hydrazide;hydrate is sourced from PubChem (CID 141472933), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).