C15H15F3N2O7S — CID 141473107
6-methyl-5-[(2-methylpropan-2-yl)oxycarbonyl]-4-(trifluoromethylsulfonyloxy)pyrazolo[1,5-a]pyridine-2-carboxylic acid (PubChem CID 141473107) has the molecular formula C15H15F3N2O7S and a molecular weight of 424.35 g/mol. Its IUPAC name is 6-methyl-5-[(2-methylpropan-2-yl)oxycarbonyl]-4-(trifluoromethylsulfonyloxy)pyrazolo[1,5-a]pyridine-2-carboxylic acid.
| Compound Name | 6-methyl-5-[(2-methylpropan-2-yl)oxycarbonyl]-4-(trifluoromethylsulfonyloxy)pyrazolo[1,5-a]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 141473107 |
| Molecular Formula | C15H15F3N2O7S |
| Molecular Weight | 424.35 g/mol |
| Exact Mass | 424.06 |
| IUPAC Name | 6-methyl-5-[(2-methylpropan-2-yl)oxycarbonyl]-4-(trifluoromethylsulfonyloxy)pyrazolo[1,5-a]pyridine-2-carboxylic acid |
| SMILES | Cc1cn2nc(C(=O)O)cc2c(OS(=O)(=O)C(F)(F)F)c1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H15F3N2O7S/c1-7-6-20-9(5-8(19-20)12(21)22)11(27-28(24,25)15(16,17)18)10(7)13(23)26-14(2,3)4/h5-6H,1-4H3,(H,21,22) |
| InChIKey | XMGRJJGJRXYZRP-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 124.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.35 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|