C27H29N5O2 — CID 141473889
3-[3-ethyl-5-(5-methoxy-2-pyridinyl)-1,2,4-triazol-1-yl]-N-(4-phenylbutyl)benzamide (PubChem CID 141473889) has the molecular formula C27H29N5O2 and a molecular weight of 455.56 g/mol. Its IUPAC name is 3-[3-ethyl-5-(5-methoxy-2-pyridinyl)-1,2,4-triazol-1-yl]-N-(4-phenylbutyl)benzamide.
| Compound Name | 3-[3-ethyl-5-(5-methoxy-2-pyridinyl)-1,2,4-triazol-1-yl]-N-(4-phenylbutyl)benzamide |
|---|---|
| PubChem CID | 141473889 |
| Molecular Formula | C27H29N5O2 |
| Molecular Weight | 455.56 g/mol |
| Exact Mass | 455.23 |
| IUPAC Name | 3-[3-ethyl-5-(5-methoxy-2-pyridinyl)-1,2,4-triazol-1-yl]-N-(4-phenylbutyl)benzamide |
| SMILES | CCc1nc(-c2ccc(OC)cn2)n(-c2cccc(C(=O)NCCCCc3ccccc3)c2)n1 |
| InChI | InChI=1S/C27H29N5O2/c1-3-25-30-26(24-16-15-23(34-2)19-29-24)32(31-25)22-14-9-13-21(18-22)27(33)28-17-8-7-12-20-10-5-4-6-11-20/h4-6,9-11,13-16,18-19H,3,7-8,12,17H2,1-2H3,(H,28,33) |
| InChIKey | LUJXXPIPGCCNFX-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.56 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|