About 2-(3,3,3-trichloropropylsulfonyl)acetonitrile
2-(3,3,3-trichloropropylsulfonyl)acetonitrile (PubChem CID 141474288) has the molecular formula C5H6Cl3NO2S
and a molecular weight of 250.53 g/mol. Its IUPAC name is 2-(3,3,3-trichloropropylsulfonyl)acetonitrile.
Molecular Properties
| Compound Name | 2-(3,3,3-trichloropropylsulfonyl)acetonitrile |
| PubChem CID | 141474288 |
| Molecular Formula | C5H6Cl3NO2S |
| Molecular Weight | 250.53 g/mol |
| Exact Mass | 248.92 |
| IUPAC Name | 2-(3,3,3-trichloropropylsulfonyl)acetonitrile |
| SMILES | N#CCS(=O)(=O)CCC(Cl)(Cl)Cl |
| InChI | InChI=1S/C5H6Cl3NO2S/c6-5(7,8)1-3-12(10,11)4-2-9/h1,3-4H2 |
| InChIKey | REPWPOJVAQEDFP-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 57.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.53 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-(3,3,3-trichloropropylsulfonyl)acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,3,3-trichloropropylsulfonyl)acetonitrile?
The IUPAC name of 2-(3,3,3-trichloropropylsulfonyl)acetonitrile (CID 141474288) is 2-(3,3,3-trichloropropylsulfonyl)acetonitrile.
What is the SMILES notation for 2-(3,3,3-trichloropropylsulfonyl)acetonitrile?
The canonical SMILES for 2-(3,3,3-trichloropropylsulfonyl)acetonitrile is N#CCS(=O)(=O)CCC(Cl)(Cl)Cl.
What is the InChIKey of 2-(3,3,3-trichloropropylsulfonyl)acetonitrile?
The InChIKey is REPWPOJVAQEDFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6Cl3NO2S/c6-5(7,8)1-3-12(10,11)4-2-9/h1,3-4H2.
What are the key properties of 2-(3,3,3-trichloropropylsulfonyl)acetonitrile?
2-(3,3,3-trichloropropylsulfonyl)acetonitrile has a molecular weight of 250.53 g/mol, XLogP of 1.69, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,3,3-trichloropropylsulfonyl)acetonitrile is sourced from PubChem (CID 141474288), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).