C12H22O13 — CID 141474922
2,3,4,5,6-pentahydroxy-2-[(3R,4S,5S,6R)-2,3,4,5-tetrahydroxy-6-(hydroxymethyl)oxan-2-yl]hexanoic acid (PubChem CID 141474922) has the molecular formula C12H22O13 and a molecular weight of 374.30 g/mol. Its IUPAC name is 2,3,4,5,6-pentahydroxy-2-[(3R,4S,5S,6R)-2,3,4,5-tetrahydroxy-6-(hydroxymethyl)oxan-2-yl]hexanoic acid.
| Compound Name | 2,3,4,5,6-pentahydroxy-2-[(3R,4S,5S,6R)-2,3,4,5-tetrahydroxy-6-(hydroxymethyl)oxan-2-yl]hexanoic acid |
|---|---|
| PubChem CID | 141474922 |
| Molecular Formula | C12H22O13 |
| Molecular Weight | 374.30 g/mol |
| Exact Mass | 374.11 |
| IUPAC Name | 2,3,4,5,6-pentahydroxy-2-[(3R,4S,5S,6R)-2,3,4,5-tetrahydroxy-6-(hydroxymethyl)oxan-2-yl]hexanoic acid |
| SMILES | O=C(O)C(O)(C(O)C(O)C(O)CO)C1(O)O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C12H22O13/c13-1-3(15)5(16)8(19)11(23,10(21)22)12(24)9(20)7(18)6(17)4(2-14)25-12/h3-9,13-20,23-24H,1-2H2,(H,21,22)/t3?,4-,5?,6-,7+,8?,9-,11?,12?/m1/s1 |
| InChIKey | RPWMBOWMASNITL-WOZKSKRCSA-N |
| XLogP | -6.96 |
| TPSA | 248.83 Ų |
| H-Bond Donors | 11 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.30 |
| LogP ≤ 5 | -6.96 |
| H-Bond Donors ≤ 5 | 11 |
| H-Bond Acceptors ≤ 10 | 12 |