About 2-pyrrolidin-1-ylacetyl fluoride
2-pyrrolidin-1-ylacetyl fluoride (PubChem CID 141475302) has the molecular formula C6H10FNO
and a molecular weight of 131.15 g/mol. Its IUPAC name is 2-pyrrolidin-1-ylacetyl fluoride.
Molecular Properties
| Compound Name | 2-pyrrolidin-1-ylacetyl fluoride |
| PubChem CID | 141475302 |
| Molecular Formula | C6H10FNO |
| Molecular Weight | 131.15 g/mol |
| Exact Mass | 131.07 |
| IUPAC Name | 2-pyrrolidin-1-ylacetyl fluoride |
| SMILES | O=C(F)CN1CCCC1 |
| InChI | InChI=1S/C6H10FNO/c7-6(9)5-8-3-1-2-4-8/h1-5H2 |
| InChIKey | ZJXVPFCYIZWFGW-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 131.15 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-pyrrolidin-1-ylacetyl fluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-pyrrolidin-1-ylacetyl fluoride?
The IUPAC name of 2-pyrrolidin-1-ylacetyl fluoride (CID 141475302) is 2-pyrrolidin-1-ylacetyl fluoride.
What is the SMILES notation for 2-pyrrolidin-1-ylacetyl fluoride?
The canonical SMILES for 2-pyrrolidin-1-ylacetyl fluoride is O=C(F)CN1CCCC1.
What is the InChIKey of 2-pyrrolidin-1-ylacetyl fluoride?
The InChIKey is ZJXVPFCYIZWFGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10FNO/c7-6(9)5-8-3-1-2-4-8/h1-5H2.
What are the key properties of 2-pyrrolidin-1-ylacetyl fluoride?
2-pyrrolidin-1-ylacetyl fluoride has a molecular weight of 131.15 g/mol, XLogP of 0.58, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pyrrolidin-1-ylacetyl fluoride is sourced from PubChem (CID 141475302), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).