C20H20F24N3O4S+ — CID 141475309
3-[[2-[[bis(1,1,2,2,3,3,4,4,4-nonafluorobutyl)amino]-difluoromethyl]-2,3,3,3-tetrafluoropropanoyl]amino]propyl-dimethyl-(3-sulfopropyl)azanium (PubChem CID 141475309) has the molecular formula C20H20F24N3O4S+ and a molecular weight of 854.42 g/mol. Its IUPAC name is 3-[[2-[[bis(1,1,2,2,3,3,4,4,4-nonafluorobutyl)amino]-difluoromethyl]-2,3,3,3-tetrafluoropropanoyl]amino]propyl-dimethyl-(3-sulfopropyl)azanium.
| Compound Name | 3-[[2-[[bis(1,1,2,2,3,3,4,4,4-nonafluorobutyl)amino]-difluoromethyl]-2,3,3,3-tetrafluoropropanoyl]amino]propyl-dimethyl-(3-sulfopropyl)azanium |
|---|---|
| PubChem CID | 141475309 |
| Molecular Formula | C20H20F24N3O4S+ |
| Molecular Weight | 854.42 g/mol |
| Exact Mass | 854.08 |
| IUPAC Name | 3-[[2-[[bis(1,1,2,2,3,3,4,4,4-nonafluorobutyl)amino]-difluoromethyl]-2,3,3,3-tetrafluoropropanoyl]amino]propyl-dimethyl-(3-sulfopropyl)azanium |
| SMILES | C[N+](C)(CCCNC(=O)C(F)(C(F)(F)F)C(F)(F)N(C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)CCCS(=O)(=O)O |
| InChI | InChI=1S/C20H19F24N3O4S/c1-47(2,7-4-8-52(49,50)51)6-3-5-45-9(48)10(21,15(30,31)32)18(39,40)46(19(41,42)13(26,27)11(22,23)16(33,34)35)20(43,44)14(28,29)12(24,25)17(36,37)38/h3-8H2,1-2H3,(H-,45,48,49,50,51)/p+1 |
| InChIKey | UTVDQFPDCVFZIC-UHFFFAOYSA-O |
| XLogP | 6.86 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 854.42 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|