C23H48OSi — CID 141475322
(2-cyclohexyl-3,3,4,4,5,5,6-heptamethylheptan-2-yl)-methoxy-dimethylsilane (PubChem CID 141475322) has the molecular formula C23H48OSi and a molecular weight of 368.72 g/mol. Its IUPAC name is (2-cyclohexyl-3,3,4,4,5,5,6-heptamethylheptan-2-yl)-methoxy-dimethylsilane.
| Compound Name | (2-cyclohexyl-3,3,4,4,5,5,6-heptamethylheptan-2-yl)-methoxy-dimethylsilane |
|---|---|
| PubChem CID | 141475322 |
| Molecular Formula | C23H48OSi |
| Molecular Weight | 368.72 g/mol |
| Exact Mass | 368.35 |
| IUPAC Name | (2-cyclohexyl-3,3,4,4,5,5,6-heptamethylheptan-2-yl)-methoxy-dimethylsilane |
| SMILES | CO[Si](C)(C)C(C)(C1CCCCC1)C(C)(C)C(C)(C)C(C)(C)C(C)C |
| InChI | InChI=1S/C23H48OSi/c1-18(2)20(3,4)21(5,6)22(7,8)23(9,25(11,12)24-10)19-16-14-13-15-17-19/h18-19H,13-17H2,1-12H3 |
| InChIKey | IIIAONFTNSFZEP-UHFFFAOYSA-N |
| XLogP | 7.91 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.72 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|