C18H22N2O5S — CID 141475530
ethyl 2-methylsulfonyl-3-[3-(5-prop-1-ynyl-2-pyridinyl)-4,5-dihydro-1,2-oxazol-5-yl]butanoate (PubChem CID 141475530) has the molecular formula C18H22N2O5S and a molecular weight of 378.45 g/mol. Its IUPAC name is ethyl 2-methylsulfonyl-3-[3-(5-prop-1-ynyl-2-pyridinyl)-4,5-dihydro-1,2-oxazol-5-yl]butanoate.
| Compound Name | ethyl 2-methylsulfonyl-3-[3-(5-prop-1-ynyl-2-pyridinyl)-4,5-dihydro-1,2-oxazol-5-yl]butanoate |
|---|---|
| PubChem CID | 141475530 |
| Molecular Formula | C18H22N2O5S |
| Molecular Weight | 378.45 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | ethyl 2-methylsulfonyl-3-[3-(5-prop-1-ynyl-2-pyridinyl)-4,5-dihydro-1,2-oxazol-5-yl]butanoate |
| SMILES | CC#Cc1ccc(C2=NOC(C(C)C(C(=O)OCC)S(C)(=O)=O)C2)nc1 |
| InChI | InChI=1S/C18H22N2O5S/c1-5-7-13-8-9-14(19-11-13)15-10-16(25-20-15)12(3)17(26(4,22)23)18(21)24-6-2/h8-9,11-12,16-17H,6,10H2,1-4H3 |
| InChIKey | CBFNYFBDYYMJQN-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 94.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.45 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|