C7H12O — CID 141475709
1,2,3,4,4,5,5,6-octadeuterio-6-methylcyclohex-2-en-1-ol (PubChem CID 141475709) has the molecular formula C7H12O and a molecular weight of 120.22 g/mol. Its IUPAC name is 1,2,3,4,4,5,5,6-octadeuterio-6-methylcyclohex-2-en-1-ol.
| Compound Name | 1,2,3,4,4,5,5,6-octadeuterio-6-methylcyclohex-2-en-1-ol |
|---|---|
| PubChem CID | 141475709 |
| Molecular Formula | C7H12O |
| Molecular Weight | 120.22 g/mol |
| Exact Mass | 120.14 |
| IUPAC Name | 1,2,3,4,4,5,5,6-octadeuterio-6-methylcyclohex-2-en-1-ol |
| SMILES | [2H]C1=C([2H])C([2H])(O)C([2H])(C)C([2H])([2H])C1([2H])[2H] |
| InChI | InChI=1S/C7H12O/c1-6-4-2-3-5-7(6)8/h3,5-8H,2,4H2,1H3/i2D2,3D,4D2,5D,6D,7D |
| InChIKey | IEALXHQYEVTYMO-INXCXMEYSA-N |
| XLogP | 1.33 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 120.22 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|