About 4-amino-3-fluoro-1,3-oxazolidin-2-one
4-amino-3-fluoro-1,3-oxazolidin-2-one (PubChem CID 141476852) has the molecular formula C3H5FN2O2
and a molecular weight of 120.08 g/mol. Its IUPAC name is 4-amino-3-fluoro-1,3-oxazolidin-2-one.
Molecular Properties
| Compound Name | 4-amino-3-fluoro-1,3-oxazolidin-2-one |
| PubChem CID | 141476852 |
| Molecular Formula | C3H5FN2O2 |
| Molecular Weight | 120.08 g/mol |
| Exact Mass | 120.03 |
| IUPAC Name | 4-amino-3-fluoro-1,3-oxazolidin-2-one |
| SMILES | NC1COC(=O)N1F |
| InChI | InChI=1S/C3H5FN2O2/c4-6-2(5)1-8-3(6)7/h2H,1,5H2 |
| InChIKey | RGAQXGZPSSVDGI-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 120.08 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze 4-amino-3-fluoro-1,3-oxazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-3-fluoro-1,3-oxazolidin-2-one?
The IUPAC name of 4-amino-3-fluoro-1,3-oxazolidin-2-one (CID 141476852) is 4-amino-3-fluoro-1,3-oxazolidin-2-one.
What is the SMILES notation for 4-amino-3-fluoro-1,3-oxazolidin-2-one?
The canonical SMILES for 4-amino-3-fluoro-1,3-oxazolidin-2-one is NC1COC(=O)N1F.
What is the InChIKey of 4-amino-3-fluoro-1,3-oxazolidin-2-one?
The InChIKey is RGAQXGZPSSVDGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H5FN2O2/c4-6-2(5)1-8-3(6)7/h2H,1,5H2.
What are the key properties of 4-amino-3-fluoro-1,3-oxazolidin-2-one?
4-amino-3-fluoro-1,3-oxazolidin-2-one has a molecular weight of 120.08 g/mol, XLogP of -0.39, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-3-fluoro-1,3-oxazolidin-2-one is sourced from PubChem (CID 141476852), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).