C14H35NO4Si3 — CID 141476916
[(2R,3S,4R,5R)-3,4,5-tris(trimethylsilyloxy)oxolan-2-yl]methanamine (PubChem CID 141476916) has the molecular formula C14H35NO4Si3 and a molecular weight of 365.70 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-3,4,5-tris(trimethylsilyloxy)oxolan-2-yl]methanamine.
| Compound Name | [(2R,3S,4R,5R)-3,4,5-tris(trimethylsilyloxy)oxolan-2-yl]methanamine |
|---|---|
| PubChem CID | 141476916 |
| Molecular Formula | C14H35NO4Si3 |
| Molecular Weight | 365.70 g/mol |
| Exact Mass | 365.19 |
| IUPAC Name | [(2R,3S,4R,5R)-3,4,5-tris(trimethylsilyloxy)oxolan-2-yl]methanamine |
| SMILES | C[Si](C)(C)O[C@H]1O[C@H](CN)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C |
| InChI | InChI=1S/C14H35NO4Si3/c1-20(2,3)17-12-11(10-15)16-14(19-22(7,8)9)13(12)18-21(4,5)6/h11-14H,10,15H2,1-9H3/t11-,12+,13-,14-/m1/s1 |
| InChIKey | QJEVJVWNEGQICQ-XJFOESAGSA-N |
| XLogP | 2.96 |
| TPSA | 62.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.70 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|