C16H17BrN6O4S — CID 141478397
N-(4-bromophenyl)-4-[2-[(5-nitro-1,3-thiazol-2-yl)amino]-2-oxoethyl]piperazine-1-carboxamide (PubChem CID 141478397) has the molecular formula C16H17BrN6O4S and a molecular weight of 469.32 g/mol. Its IUPAC name is N-(4-bromophenyl)-4-[2-[(5-nitro-1,3-thiazol-2-yl)amino]-2-oxoethyl]piperazine-1-carboxamide.
| Compound Name | N-(4-bromophenyl)-4-[2-[(5-nitro-1,3-thiazol-2-yl)amino]-2-oxoethyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 141478397 |
| Molecular Formula | C16H17BrN6O4S |
| Molecular Weight | 469.32 g/mol |
| Exact Mass | 468.02 |
| IUPAC Name | N-(4-bromophenyl)-4-[2-[(5-nitro-1,3-thiazol-2-yl)amino]-2-oxoethyl]piperazine-1-carboxamide |
| SMILES | O=C(CN1CCN(C(=O)Nc2ccc(Br)cc2)CC1)Nc1ncc([N+](=O)[O-])s1 |
| InChI | InChI=1S/C16H17BrN6O4S/c17-11-1-3-12(4-2-11)19-16(25)22-7-5-21(6-8-22)10-13(24)20-15-18-9-14(28-15)23(26)27/h1-4,9H,5-8,10H2,(H,19,25)(H,18,20,24) |
| InChIKey | VCVFCBFQAFUHIR-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 120.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.32 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|