C55H42Cl2N10O3 — CID 141478477
(1E,6E)-3,5-bis[4-[9-[(6-chloro-3-pyridinyl)methyl]purin-6-yl]oxyphenyl]-1,7-bis(4-methylphenyl)hepta-1,6-dien-4-one (PubChem CID 141478477) has the molecular formula C55H42Cl2N10O3 and a molecular weight of 961.91 g/mol. Its IUPAC name is (1E,6E)-3,5-bis[4-[9-[(6-chloro-3-pyridinyl)methyl]purin-6-yl]oxyphenyl]-1,7-bis(4-methylphenyl)hepta-1,6-dien-4-one.
| Compound Name | (1E,6E)-3,5-bis[4-[9-[(6-chloro-3-pyridinyl)methyl]purin-6-yl]oxyphenyl]-1,7-bis(4-methylphenyl)hepta-1,6-dien-4-one |
|---|---|
| PubChem CID | 141478477 |
| Molecular Formula | C55H42Cl2N10O3 |
| Molecular Weight | 961.91 g/mol |
| Exact Mass | 960.28 |
| IUPAC Name | (1E,6E)-3,5-bis[4-[9-[(6-chloro-3-pyridinyl)methyl]purin-6-yl]oxyphenyl]-1,7-bis(4-methylphenyl)hepta-1,6-dien-4-one |
| SMILES | Cc1ccc(/C=C/C(C(=O)C(/C=C/c2ccc(C)cc2)c2ccc(Oc3ncnc4c3ncn4Cc3ccc(Cl)nc3)cc2)c2ccc(Oc3ncnc4c3ncn4Cc3ccc(Cl)nc3)cc2)cc1 |
| InChI | InChI=1S/C55H42Cl2N10O3/c1-35-3-7-37(8-4-35)11-23-45(41-15-19-43(20-16-41)69-54-49-52(60-31-62-54)66(33-64-49)29-39-13-25-47(56)58-27-39)51(68)46(24-12-38-9-5-36(2)6-10-38)42-17-21-44(22-18-42)70-55-50-53(61-32-63-55)67(34-65-50)30-40-14-26-48(57)59-28-40/h3-28,31-34,45-46H,29-30H2,1-2H3/b23-11+,24-12+ |
| InChIKey | ZNJAOEIGCGXQFI-ASIDMNOUSA-N |
| XLogP | 12.22 |
| TPSA | 148.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 70 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 961.91 |
| LogP ≤ 5 | 12.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|