C55H42N8O3 — CID 141478488
(1E,6E)-3,5-bis[4-(9-benzylpurin-6-yl)oxyphenyl]-1,7-diphenylhepta-1,6-dien-4-one (PubChem CID 141478488) has the molecular formula C55H42N8O3 and a molecular weight of 862.99 g/mol. Its IUPAC name is (1E,6E)-3,5-bis[4-(9-benzylpurin-6-yl)oxyphenyl]-1,7-diphenylhepta-1,6-dien-4-one.
| Compound Name | (1E,6E)-3,5-bis[4-(9-benzylpurin-6-yl)oxyphenyl]-1,7-diphenylhepta-1,6-dien-4-one |
|---|---|
| PubChem CID | 141478488 |
| Molecular Formula | C55H42N8O3 |
| Molecular Weight | 862.99 g/mol |
| Exact Mass | 862.34 |
| IUPAC Name | (1E,6E)-3,5-bis[4-(9-benzylpurin-6-yl)oxyphenyl]-1,7-diphenylhepta-1,6-dien-4-one |
| SMILES | O=C(C(/C=C/c1ccccc1)c1ccc(Oc2ncnc3c2ncn3Cc2ccccc2)cc1)C(/C=C/c1ccccc1)c1ccc(Oc2ncnc3c2ncn3Cc2ccccc2)cc1 |
| InChI | InChI=1S/C55H42N8O3/c64-51(47(31-21-39-13-5-1-6-14-39)43-23-27-45(28-24-43)65-54-49-52(56-35-58-54)62(37-60-49)33-41-17-9-3-10-18-41)48(32-22-40-15-7-2-8-16-40)44-25-29-46(30-26-44)66-55-50-53(57-36-59-55)63(38-61-50)34-42-19-11-4-12-20-42/h1-32,35-38,47-48H,33-34H2/b31-21+,32-22+ |
| InChIKey | LFNQOWNJLVPFRS-RWRHWQIFSA-N |
| XLogP | 11.51 |
| TPSA | 122.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 66 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 862.99 |
| LogP ≤ 5 | 11.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |