About 2-heptyl-2,4-dimethyl-1,3-dioxole
2-heptyl-2,4-dimethyl-1,3-dioxole (PubChem CID 141478865) has the molecular formula C12H22O2
and a molecular weight of 198.31 g/mol. Its IUPAC name is 2-heptyl-2,4-dimethyl-1,3-dioxole.
Molecular Properties
| Compound Name | 2-heptyl-2,4-dimethyl-1,3-dioxole |
| PubChem CID | 141478865 |
| Molecular Formula | C12H22O2 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.16 |
| IUPAC Name | 2-heptyl-2,4-dimethyl-1,3-dioxole |
| SMILES | CCCCCCCC1(C)OC=C(C)O1 |
| InChI | InChI=1S/C12H22O2/c1-4-5-6-7-8-9-12(3)13-10-11(2)14-12/h10H,4-9H2,1-3H3 |
| InChIKey | PUOHNRNZJPKYIL-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-heptyl-2,4-dimethyl-1,3-dioxole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-heptyl-2,4-dimethyl-1,3-dioxole?
The IUPAC name of 2-heptyl-2,4-dimethyl-1,3-dioxole (CID 141478865) is 2-heptyl-2,4-dimethyl-1,3-dioxole.
What is the SMILES notation for 2-heptyl-2,4-dimethyl-1,3-dioxole?
The canonical SMILES for 2-heptyl-2,4-dimethyl-1,3-dioxole is CCCCCCCC1(C)OC=C(C)O1.
What is the InChIKey of 2-heptyl-2,4-dimethyl-1,3-dioxole?
The InChIKey is PUOHNRNZJPKYIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22O2/c1-4-5-6-7-8-9-12(3)13-10-11(2)14-12/h10H,4-9H2,1-3H3.
What are the key properties of 2-heptyl-2,4-dimethyl-1,3-dioxole?
2-heptyl-2,4-dimethyl-1,3-dioxole has a molecular weight of 198.31 g/mol, XLogP of 3.97, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-heptyl-2,4-dimethyl-1,3-dioxole is sourced from PubChem (CID 141478865), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).