C11H20O2 — CID 141478872
2-heptyl-4-methyl-1,3-dioxole (PubChem CID 141478872) has the molecular formula C11H20O2 and a molecular weight of 184.28 g/mol. Its IUPAC name is 2-heptyl-4-methyl-1,3-dioxole.
| Compound Name | 2-heptyl-4-methyl-1,3-dioxole |
|---|---|
| PubChem CID | 141478872 |
| Molecular Formula | C11H20O2 |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.15 |
| IUPAC Name | 2-heptyl-4-methyl-1,3-dioxole |
| SMILES | CCCCCCCC1OC=C(C)O1 |
| InChI | InChI=1S/C11H20O2/c1-3-4-5-6-7-8-11-12-9-10(2)13-11/h9,11H,3-8H2,1-2H3 |
| InChIKey | DNIGOJCGHYOTQE-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|