C26H42O4 — CID 141480593
methyl (Z,5R)-7-[(1S,2S,6R,8S)-8-(2,2-dimethylbutoxy)-2,6-dimethyl-1,2,6,7,8,8a-hexahydronaphthalen-1-yl]-5-hydroxyhept-2-enoate (PubChem CID 141480593) has the molecular formula C26H42O4 and a molecular weight of 418.62 g/mol. Its IUPAC name is methyl (Z,5R)-7-[(1S,2S,6R,8S)-8-(2,2-dimethylbutoxy)-2,6-dimethyl-1,2,6,7,8,8a-hexahydronaphthalen-1-yl]-5-hydroxyhept-2-enoate.
| Compound Name | methyl (Z,5R)-7-[(1S,2S,6R,8S)-8-(2,2-dimethylbutoxy)-2,6-dimethyl-1,2,6,7,8,8a-hexahydronaphthalen-1-yl]-5-hydroxyhept-2-enoate |
|---|---|
| PubChem CID | 141480593 |
| Molecular Formula | C26H42O4 |
| Molecular Weight | 418.62 g/mol |
| Exact Mass | 418.31 |
| IUPAC Name | methyl (Z,5R)-7-[(1S,2S,6R,8S)-8-(2,2-dimethylbutoxy)-2,6-dimethyl-1,2,6,7,8,8a-hexahydronaphthalen-1-yl]-5-hydroxyhept-2-enoate |
| SMILES | CCC(C)(C)CO[C@H]1C[C@@H](C)C=C2C=C[C@H](C)[C@H](CC[C@@H](O)C/C=C\C(=O)OC)C21 |
| InChI | InChI=1S/C26H42O4/c1-7-26(4,5)17-30-23-16-18(2)15-20-12-11-19(3)22(25(20)23)14-13-21(27)9-8-10-24(28)29-6/h8,10-12,15,18-19,21-23,25,27H,7,9,13-14,16-17H2,1-6H3/b10-8-/t18-,19-,21-,22-,23-,25?/m0/s1 |
| InChIKey | MSOYXFDPAPXZAV-AOKADBJMSA-N |
| XLogP | 5.47 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.62 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|