C28H28ClN5O4 — CID 141481497
ethyl 5-chloro-3-[[1-[2-(5-oxo-4H-1,2,4-oxadiazol-3-yl)phenyl]indol-5-yl]methyl]-2-pentylimidazole-4-carboxylate (PubChem CID 141481497) has the molecular formula C28H28ClN5O4 and a molecular weight of 534.02 g/mol. Its IUPAC name is ethyl 5-chloro-3-[[1-[2-(5-oxo-4H-1,2,4-oxadiazol-3-yl)phenyl]indol-5-yl]methyl]-2-pentylimidazole-4-carboxylate.
| Compound Name | ethyl 5-chloro-3-[[1-[2-(5-oxo-4H-1,2,4-oxadiazol-3-yl)phenyl]indol-5-yl]methyl]-2-pentylimidazole-4-carboxylate |
|---|---|
| PubChem CID | 141481497 |
| Molecular Formula | C28H28ClN5O4 |
| Molecular Weight | 534.02 g/mol |
| Exact Mass | 533.18 |
| IUPAC Name | ethyl 5-chloro-3-[[1-[2-(5-oxo-4H-1,2,4-oxadiazol-3-yl)phenyl]indol-5-yl]methyl]-2-pentylimidazole-4-carboxylate |
| SMILES | CCCCCc1nc(Cl)c(C(=O)OCC)n1Cc1ccc2c(ccn2-c2ccccc2-c2noc(=O)[nH]2)c1 |
| InChI | InChI=1S/C28H28ClN5O4/c1-3-5-6-11-23-30-25(29)24(27(35)37-4-2)34(23)17-18-12-13-21-19(16-18)14-15-33(21)22-10-8-7-9-20(22)26-31-28(36)38-32-26/h7-10,12-16H,3-6,11,17H2,1-2H3,(H,31,32,36) |
| InChIKey | UFXDHYYQPFEVBG-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 107.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.02 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|