C19H31BO2 — CID 141481578
3-[(1Z)-cyclononen-1-yl]-5,9,9-trimethyl-2,4-dioxa-3-boratricyclo[6.1.1.01,5]decane (PubChem CID 141481578) has the molecular formula C19H31BO2 and a molecular weight of 302.27 g/mol. Its IUPAC name is 3-[(1Z)-cyclononen-1-yl]-5,9,9-trimethyl-2,4-dioxa-3-boratricyclo[6.1.1.01,5]decane.
| Compound Name | 3-[(1Z)-cyclononen-1-yl]-5,9,9-trimethyl-2,4-dioxa-3-boratricyclo[6.1.1.01,5]decane |
|---|---|
| PubChem CID | 141481578 |
| Molecular Formula | C19H31BO2 |
| Molecular Weight | 302.27 g/mol |
| Exact Mass | 302.24 |
| IUPAC Name | 3-[(1Z)-cyclononen-1-yl]-5,9,9-trimethyl-2,4-dioxa-3-boratricyclo[6.1.1.01,5]decane |
| SMILES | CC12CCC3CC1(OB(/C1=C/CCCCCCC1)O2)C3(C)C |
| InChI | InChI=1S/C19H31BO2/c1-17(2)15-12-13-18(3)19(17,14-15)22-20(21-18)16-10-8-6-4-5-7-9-11-16/h10,15H,4-9,11-14H2,1-3H3/b16-10+ |
| InChIKey | QGRSHJZVLRUJQN-MHWRWJLKSA-N |
| XLogP | 5.07 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.27 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|