C22H23BrN8 — CID 141481838
5-bromo-4-N-(1H-indazol-5-yl)-2-N-[4-(4-methylpiperazin-1-yl)phenyl]pyrimidine-2,4-diamine (PubChem CID 141481838) has the molecular formula C22H23BrN8 and a molecular weight of 479.39 g/mol. Its IUPAC name is 5-bromo-4-N-(1H-indazol-5-yl)-2-N-[4-(4-methylpiperazin-1-yl)phenyl]pyrimidine-2,4-diamine.
| Compound Name | 5-bromo-4-N-(1H-indazol-5-yl)-2-N-[4-(4-methylpiperazin-1-yl)phenyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 141481838 |
| Molecular Formula | C22H23BrN8 |
| Molecular Weight | 479.39 g/mol |
| Exact Mass | 478.12 |
| IUPAC Name | 5-bromo-4-N-(1H-indazol-5-yl)-2-N-[4-(4-methylpiperazin-1-yl)phenyl]pyrimidine-2,4-diamine |
| SMILES | CN1CCN(c2ccc(Nc3ncc(Br)c(Nc4ccc5[nH]ncc5c4)n3)cc2)CC1 |
| InChI | InChI=1S/C22H23BrN8/c1-30-8-10-31(11-9-30)18-5-2-16(3-6-18)27-22-24-14-19(23)21(28-22)26-17-4-7-20-15(12-17)13-25-29-20/h2-7,12-14H,8-11H2,1H3,(H,25,29)(H2,24,26,27,28) |
| InChIKey | WEHBYMAQEWSDGM-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 85.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.39 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|