sodium 5,5-diethyl-1-methylpyrimidin-3-ide-2,4,6-trione

C9H13N2NaO3 — CID 14148198

IUPACsodium 5,5-diethyl-1-methylpyrimidin-3-ide-2,4,6-trione
SMILESCCC1(CC)C(=O)[N-]C(=O)N(C)C1=O.[Na+]
InChIInChI=1S/C9H14N2O3.Na/c1-4-9(5-2)6(12)10-8(14)11(3)7(9)13;/h4-5H2,1-3H3,(H,10,12,14);/q;+1/p-1
InChIKeyRIJRFNRKNTXEGB-UHFFFAOYSA-M
MW220.20 g/mol
LogP-1.71
Rot. Bonds2

About sodium 5,5-diethyl-1-methylpyrimidin-3-ide-2,4,6-trione

sodium 5,5-diethyl-1-methylpyrimidin-3-ide-2,4,6-trione (PubChem CID 14148198) has the molecular formula C9H13N2NaO3 and a molecular weight of 220.20 g/mol. Its IUPAC name is sodium 5,5-diethyl-1-methylpyrimidin-3-ide-2,4,6-trione.

Molecular Properties

Compound Namesodium 5,5-diethyl-1-methylpyrimidin-3-ide-2,4,6-trione
PubChem CID14148198
Molecular FormulaC9H13N2NaO3
Molecular Weight220.20 g/mol
Exact Mass220.08
IUPAC Namesodium 5,5-diethyl-1-methylpyrimidin-3-ide-2,4,6-trione
SMILESCCC1(CC)C(=O)[N-]C(=O)N(C)C1=O.[Na+]
InChIInChI=1S/C9H14N2O3.Na/c1-4-9(5-2)6(12)10-8(14)11(3)7(9)13;/h4-5H2,1-3H3,(H,10,12,14);/q;+1/p-1
InChIKeyRIJRFNRKNTXEGB-UHFFFAOYSA-M
XLogP-1.71
TPSA68.55 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500220.20
LogP ≤ 5-1.71
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}

Analyze sodium 5,5-diethyl-1-methylpyrimidin-3-ide-2,4,6-trione with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of sodium 5,5-diethyl-1-methylpyrimidin-3-ide-2,4,6-trione?
The IUPAC name of sodium 5,5-diethyl-1-methylpyrimidin-3-ide-2,4,6-trione (CID 14148198) is sodium 5,5-diethyl-1-methylpyrimidin-3-ide-2,4,6-trione.
What is the SMILES notation for sodium 5,5-diethyl-1-methylpyrimidin-3-ide-2,4,6-trione?
The canonical SMILES for sodium 5,5-diethyl-1-methylpyrimidin-3-ide-2,4,6-trione is CCC1(CC)C(=O)[N-]C(=O)N(C)C1=O.[Na+].
What is the InChIKey of sodium 5,5-diethyl-1-methylpyrimidin-3-ide-2,4,6-trione?
The InChIKey is RIJRFNRKNTXEGB-UHFFFAOYSA-M. The full InChI is InChI=1S/C9H14N2O3.Na/c1-4-9(5-2)6(12)10-8(14)11(3)7(9)13;/h4-5H2,1-3H3,(H,10,12,14);/q;+1/p-1.
What are the key properties of sodium 5,5-diethyl-1-methylpyrimidin-3-ide-2,4,6-trione?
sodium 5,5-diethyl-1-methylpyrimidin-3-ide-2,4,6-trione has a molecular weight of 220.20 g/mol, XLogP of -1.71, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 5,5-diethyl-1-methylpyrimidin-3-ide-2,4,6-trione is sourced from PubChem (CID 14148198), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).